C14H16F12N2O4S — CID 174135362
1,1,2,2,3,3-hexafluoro-4-[[1-(2,2,3,3,4,4-hexafluoropentyl)pyrrolidine-2-carbonyl]amino]butane-1-sulfonic acid (PubChem CID 174135362) has the molecular formula C14H16F12N2O4S and a molecular weight of 536.34 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-4-[[1-(2,2,3,3,4,4-hexafluoropentyl)pyrrolidine-2-carbonyl]amino]butane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-4-[[1-(2,2,3,3,4,4-hexafluoropentyl)pyrrolidine-2-carbonyl]amino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 174135362 |
| Molecular Formula | C14H16F12N2O4S |
| Molecular Weight | 536.34 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-4-[[1-(2,2,3,3,4,4-hexafluoropentyl)pyrrolidine-2-carbonyl]amino]butane-1-sulfonic acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)CN1CCCC1C(=O)NCC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H16F12N2O4S/c1-9(15,16)12(21,22)11(19,20)6-28-4-2-3-7(28)8(29)27-5-10(17,18)13(23,24)14(25,26)33(30,31)32/h7H,2-6H2,1H3,(H,27,29)(H,30,31,32) |
| InChIKey | JIBCLGFVSUPQBM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|