About CID 174135522
CID 174135522 (PubChem CID 174135522) has the molecular formula C58H31B8NO
and a molecular weight of 844.39 g/mol.
Molecular Properties
| Compound Name | CID 174135522 |
| PubChem CID | 174135522 |
| Molecular Formula | C58H31B8NO |
| Molecular Weight | 844.39 g/mol |
| Exact Mass | 845.32 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(N(c2cccc(-c3cccc4oc5c6ccccc6ccc5c34)c2)c2c([B])c([B])c(-c3cccc(-c4ccccc4)c3)c([B])c2[B])c([B])c([B])c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C58H31B8NO/c59-48-45(36-26-24-34(25-27-36)32-12-3-1-4-13-32)49(60)53(64)56(52(48)63)67(57-54(65)50(61)46(51(62)55(57)66)39-19-9-17-37(30-39)33-14-5-2-6-15-33)40-20-10-18-38(31-40)41-22-11-23-44-47(41)43-29-28-35-16-7-8-21-42(35)58(43)68-44/h1-31H |
| InChIKey | KBNKVPSTMCQVPT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 844.39 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174135522 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174135522?
The IUPAC name of CID 174135522 (CID 174135522) is not available.
What is the SMILES notation for CID 174135522?
The canonical SMILES for CID 174135522 is [B]c1c([B])c(N(c2cccc(-c3cccc4oc5c6ccccc6ccc5c34)c2)c2c([B])c([B])c(-c3cccc(-c4ccccc4)c3)c([B])c2[B])c([B])c([B])c1-c1ccc(-c2ccccc2)cc1.
What is the InChIKey of CID 174135522?
The InChIKey is KBNKVPSTMCQVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C58H31B8NO/c59-48-45(36-26-24-34(25-27-36)32-12-3-1-4-13-32)49(60)53(64)56(52(48)63)67(57-54(65)50(61)46(51(62)55(57)66)39-19-9-17-37(30-39)33-14-5-2-6-15-33)40-20-10-18-38(31-40)41-22-11-23-44-47(41)43-29-28-35-16-7-8-21-42(35)58(43)68-44/h1-31H.
What are the key properties of CID 174135522?
CID 174135522 has a molecular weight of 844.39 g/mol, XLogP of 6.89, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174135522 is sourced from PubChem (CID 174135522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).