C54H42N2O6Si2 — CID 174136404
trimethoxy-[4-[4-[4-tris(trideca-1,3,5,7,9,11-hexaynoxy)silylbutyl]piperazin-1-yl]butyl]silane (PubChem CID 174136404) has the molecular formula C54H42N2O6Si2 and a molecular weight of 871.11 g/mol. Its IUPAC name is trimethoxy-[4-[4-[4-tris(trideca-1,3,5,7,9,11-hexaynoxy)silylbutyl]piperazin-1-yl]butyl]silane.
| Compound Name | trimethoxy-[4-[4-[4-tris(trideca-1,3,5,7,9,11-hexaynoxy)silylbutyl]piperazin-1-yl]butyl]silane |
|---|---|
| PubChem CID | 174136404 |
| Molecular Formula | C54H42N2O6Si2 |
| Molecular Weight | 871.11 g/mol |
| Exact Mass | 870.26 |
| IUPAC Name | trimethoxy-[4-[4-[4-tris(trideca-1,3,5,7,9,11-hexaynoxy)silylbutyl]piperazin-1-yl]butyl]silane |
| SMILES | CC#CC#CC#CC#CC#CC#CO[Si](CCCCN1CCN(CCCC[Si](OC)(OC)OC)CC1)(OC#CC#CC#CC#CC#CC#CC)OC#CC#CC#CC#CC#CC#CC |
| InChI | InChI=1S/C54H42N2O6Si2/c1-7-10-13-16-19-22-25-28-31-34-39-50-60-64(61-51-40-35-32-29-26-23-20-17-14-11-8-2,62-52-41-36-33-30-27-24-21-18-15-12-9-3)54-43-38-45-56-48-46-55(47-49-56)44-37-42-53-63(57-4,58-5)59-6/h37-38,42-49,53-54H2,1-6H3 |
| InChIKey | LYUWKJBXQAPFLG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|