C30H64O6Si3 — CID 174137124
(3S)-3-[(3S)-5-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-triethylsilyloxyoxolan-2-yl]butanoic acid (PubChem CID 174137124) has the molecular formula C30H64O6Si3 and a molecular weight of 605.09 g/mol. Its IUPAC name is (3S)-3-[(3S)-5-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-triethylsilyloxyoxolan-2-yl]butanoic acid.
| Compound Name | (3S)-3-[(3S)-5-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-triethylsilyloxyoxolan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 174137124 |
| Molecular Formula | C30H64O6Si3 |
| Molecular Weight | 605.09 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | (3S)-3-[(3S)-5-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-triethylsilyloxyoxolan-2-yl]butanoic acid |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(CCC(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC1[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C30H64O6Si3/c1-15-39(16-2,17-3)36-26-21-24(34-28(26)23(4)20-27(31)32)18-19-25(35-38(13,14)30(8,9)10)22-33-37(11,12)29(5,6)7/h23-26,28H,15-22H2,1-14H3,(H,31,32)/t23-,24?,25?,26-,28?/m0/s1 |
| InChIKey | HRZXGVBBCMEIRZ-CZBZOKGESA-N |
| XLogP | 8.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.09 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|