C13H17NO9 — CID 174137278
[(5R,8R)-5,6-diacetyloxy-7-hydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate (PubChem CID 174137278) has the molecular formula C13H17NO9 and a molecular weight of 331.28 g/mol. Its IUPAC name is [(5R,8R)-5,6-diacetyloxy-7-hydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate.
| Compound Name | [(5R,8R)-5,6-diacetyloxy-7-hydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate |
|---|---|
| PubChem CID | 174137278 |
| Molecular Formula | C13H17NO9 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | [(5R,8R)-5,6-diacetyloxy-7-hydroxy-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-8-yl] acetate |
| SMILES | CC(=O)OC1C(O)[C@H](OC(C)=O)C2COC(=O)N2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H17NO9/c1-5(15)21-10-8-4-20-13(19)14(8)12(23-7(3)17)11(9(10)18)22-6(2)16/h8-12,18H,4H2,1-3H3/t8?,9?,10-,11?,12-/m1/s1 |
| InChIKey | MPWPLJRZBJPNKE-NPLYTMANSA-N |
| XLogP | -1.07 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|