About (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine
(6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine (PubChem CID 174137830) has the molecular formula C13H20FN
and a molecular weight of 209.31 g/mol. Its IUPAC name is (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine.
Molecular Properties
| Compound Name | (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine |
| PubChem CID | 174137830 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine |
| SMILES | CC=C1/C(C)=C(C(C)C)\C=N/CCC1F |
| InChI | InChI=1S/C13H20FN/c1-5-11-10(4)12(9(2)3)8-15-7-6-13(11)14/h5,8-9,13H,6-7H2,1-4H3/b11-5?,12-10+,15-8- |
| InChIKey | MEZROLJEANJAIN-NYBXDSSGSA-N |
| XLogP | 3.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine?
The IUPAC name of (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine (CID 174137830) is (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine.
What is the SMILES notation for (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine?
The canonical SMILES for (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine is CC=C1/C(C)=C(C(C)C)\C=N/CCC1F.
What is the InChIKey of (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine?
The InChIKey is MEZROLJEANJAIN-NYBXDSSGSA-N. The full InChI is InChI=1S/C13H20FN/c1-5-11-10(4)12(9(2)3)8-15-7-6-13(11)14/h5,8-9,13H,6-7H2,1-4H3/b11-5?,12-10+,15-8-.
What are the key properties of (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine?
(6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine has a molecular weight of 209.31 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-5-ethylidene-4-fluoro-6-methyl-7-propan-2-yl-3,4-dihydro-2H-azocine is sourced from PubChem (CID 174137830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).