About 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine
3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine (PubChem CID 174137843) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine.
Molecular Properties
| Compound Name | 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine |
| PubChem CID | 174137843 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine |
| SMILES | CC/N=C(/C=C(N)C(C)C)CCNC |
| InChI | InChI=1S/C11H23N3/c1-5-14-10(6-7-13-4)8-11(12)9(2)3/h8-9,13H,5-7,12H2,1-4H3/b11-8?,14-10+ |
| InChIKey | HRMHHZRIOHHURO-XWRBZYDCSA-N |
| XLogP | 1.56 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine?
The IUPAC name of 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine (CID 174137843) is 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine.
What is the SMILES notation for 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine?
The canonical SMILES for 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine is CC/N=C(/C=C(N)C(C)C)CCNC.
What is the InChIKey of 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine?
The InChIKey is HRMHHZRIOHHURO-XWRBZYDCSA-N. The full InChI is InChI=1S/C11H23N3/c1-5-14-10(6-7-13-4)8-11(12)9(2)3/h8-9,13H,5-7,12H2,1-4H3/b11-8?,14-10+.
What are the key properties of 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine?
3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine has a molecular weight of 197.33 g/mol, XLogP of 1.56, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylimino-1-N,6-dimethylhept-4-ene-1,5-diamine is sourced from PubChem (CID 174137843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).