About CID 174138442
CID 174138442 (PubChem CID 174138442) has the molecular formula C10H21BN2O
and a molecular weight of 196.10 g/mol.
Molecular Properties
| Compound Name | CID 174138442 |
| PubChem CID | 174138442 |
| Molecular Formula | C10H21BN2O |
| Molecular Weight | 196.10 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | — |
| SMILES | [B]C(C)N(C)CCN(C)C(=O)C(C)C |
| InChI | InChI=1S/C10H21BN2O/c1-8(2)10(14)13(5)7-6-12(4)9(3)11/h8-9H,6-7H2,1-5H3 |
| InChIKey | BZVYHRZHUFTPGA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.10 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174138442 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174138442?
The IUPAC name of CID 174138442 (CID 174138442) is not available.
What is the SMILES notation for CID 174138442?
The canonical SMILES for CID 174138442 is [B]C(C)N(C)CCN(C)C(=O)C(C)C.
What is the InChIKey of CID 174138442?
The InChIKey is BZVYHRZHUFTPGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21BN2O/c1-8(2)10(14)13(5)7-6-12(4)9(3)11/h8-9H,6-7H2,1-5H3.
What are the key properties of CID 174138442?
CID 174138442 has a molecular weight of 196.10 g/mol, XLogP of 0.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174138442 is sourced from PubChem (CID 174138442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).