C13H16BN3O4S — CID 174138448
5-[2-(diaminomethylideneamino)ethylsulfanyl]-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid (PubChem CID 174138448) has the molecular formula C13H16BN3O4S and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-[2-(diaminomethylideneamino)ethylsulfanyl]-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid.
| Compound Name | 5-[2-(diaminomethylideneamino)ethylsulfanyl]-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid |
|---|---|
| PubChem CID | 174138448 |
| Molecular Formula | C13H16BN3O4S |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 5-[2-(diaminomethylideneamino)ethylsulfanyl]-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylic acid |
| SMILES | NC(N)=NCCSc1ccc2c(c1C(=O)O)OB(O)C1CC21 |
| InChI | InChI=1S/C13H16BN3O4S/c15-13(16)17-3-4-22-9-2-1-6-7-5-8(7)14(20)21-11(6)10(9)12(18)19/h1-2,7-8,20H,3-5H2,(H,18,19)(H4,15,16,17) |
| InChIKey | GZNFTPXSBRRLDM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|