C26H26BN — CID 174138943
CID 174138943 (PubChem CID 174138943) has the molecular formula C26H26BN and a molecular weight of 363.31 g/mol.
| Compound Name | CID 174138943 |
|---|---|
| PubChem CID | 174138943 |
| Molecular Formula | C26H26BN |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1ccccc1n2-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H26BN/c1-25(2)13-14-26(3,4)22-16-18(10-11-21(22)25)28-23-8-6-5-7-19(23)20-15-17(27)9-12-24(20)28/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | XQRYECCJHCNLAW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|