C32H47NO2 — CID 174138987
3-[(2R)-2-[(3R,5R,8R,9R,10S,13R,14S,17R)-3-(2-ethoxyethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]benzonitrile (PubChem CID 174138987) has the molecular formula C32H47NO2 and a molecular weight of 477.73 g/mol. Its IUPAC name is 3-[(2R)-2-[(3R,5R,8R,9R,10S,13R,14S,17R)-3-(2-ethoxyethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]benzonitrile.
| Compound Name | 3-[(2R)-2-[(3R,5R,8R,9R,10S,13R,14S,17R)-3-(2-ethoxyethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]benzonitrile |
|---|---|
| PubChem CID | 174138987 |
| Molecular Formula | C32H47NO2 |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | 3-[(2R)-2-[(3R,5R,8R,9R,10S,13R,14S,17R)-3-(2-ethoxyethyl)-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]benzonitrile |
| SMILES | CCOCC[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)Cc4cccc(C#N)c4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H47NO2/c1-4-35-17-16-32(34)15-13-26-25(20-32)8-9-28-27(26)12-14-31(3)29(10-11-30(28)31)22(2)18-23-6-5-7-24(19-23)21-33/h5-7,19,22,25-30,34H,4,8-18,20H2,1-3H3/t22-,25-,26+,27-,28-,29-,30+,31-,32+/m1/s1 |
| InChIKey | HSFXCCRKOKIPNZ-UWMZTWRQSA-N |
| XLogP | 7.16 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|