About (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane
(2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane (PubChem CID 174139245) has the molecular formula C13H27B
and a molecular weight of 194.17 g/mol. Its IUPAC name is (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane.
Molecular Properties
| Compound Name | (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane |
| PubChem CID | 174139245 |
| Molecular Formula | C13H27B |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.22 |
| IUPAC Name | (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane |
| SMILES | CCCC1CC(C)(B(C)C)C1(C)CC |
| InChI | InChI=1S/C13H27B/c1-7-9-11-10-13(4,14(5)6)12(11,3)8-2/h11H,7-10H2,1-6H3 |
| InChIKey | AGIKNLLKEBTQLX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane?
The IUPAC name of (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane (CID 174139245) is (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane.
What is the SMILES notation for (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane?
The canonical SMILES for (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane is CCCC1CC(C)(B(C)C)C1(C)CC.
What is the InChIKey of (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane?
The InChIKey is AGIKNLLKEBTQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27B/c1-7-9-11-10-13(4,14(5)6)12(11,3)8-2/h11H,7-10H2,1-6H3.
What are the key properties of (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane?
(2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane has a molecular weight of 194.17 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1,2-dimethyl-3-propylcyclobutyl)-dimethylborane is sourced from PubChem (CID 174139245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).