C17H31N2+ — CID 174140483
(Z,4R)-N-methyl-4-(1-propan-2-yl-1-propyl-3,6-dihydro-2H-pyridin-1-ium-2-yl)pent-2-en-1-imine (PubChem CID 174140483) has the molecular formula C17H31N2+ and a molecular weight of 263.45 g/mol. Its IUPAC name is (Z,4R)-N-methyl-4-(1-propan-2-yl-1-propyl-3,6-dihydro-2H-pyridin-1-ium-2-yl)pent-2-en-1-imine.
| Compound Name | (Z,4R)-N-methyl-4-(1-propan-2-yl-1-propyl-3,6-dihydro-2H-pyridin-1-ium-2-yl)pent-2-en-1-imine |
|---|---|
| PubChem CID | 174140483 |
| Molecular Formula | C17H31N2+ |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.25 |
| IUPAC Name | (Z,4R)-N-methyl-4-(1-propan-2-yl-1-propyl-3,6-dihydro-2H-pyridin-1-ium-2-yl)pent-2-en-1-imine |
| SMILES | CCC[N+]1(C(C)C)CC=CCC1[C@H](C)/C=C\C=N\C |
| InChI | InChI=1S/C17H31N2/c1-6-13-19(15(2)3)14-8-7-11-17(19)16(4)10-9-12-18-5/h7-10,12,15-17H,6,11,13-14H2,1-5H3/q+1/b10-9-,18-12+/t16-,17?,19?/m1/s1 |
| InChIKey | YKYFBKLAHXUKDB-LNESVFSRSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|