C13H14BI2N3 — CID 174141144
2-iodo-1-methyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium iodide (PubChem CID 174141144) has the molecular formula C13H14BI2N3 and a molecular weight of 476.90 g/mol. Its IUPAC name is 2-iodo-1-methyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium iodide.
| Compound Name | 2-iodo-1-methyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium iodide |
|---|---|
| PubChem CID | 174141144 |
| Molecular Formula | C13H14BI2N3 |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.94 |
| IUPAC Name | 2-iodo-1-methyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium iodide |
| SMILES | Cc1ccccc1N1B(I)N(C)c2ccc[nH+]c21.[I-] |
| InChI | InChI=1S/C13H13BIN3.HI/c1-10-6-3-4-7-11(10)18-13-12(8-5-9-16-13)17(2)14(18)15;/h3-9H,1-2H3;1H |
| InChIKey | SCRZMBCBHQPDGA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 20.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|