About CID 174141231
CID 174141231 (PubChem CID 174141231) has the molecular formula C12H13B2F3
and a molecular weight of 235.85 g/mol.
Molecular Properties
| Compound Name | CID 174141231 |
| PubChem CID | 174141231 |
| Molecular Formula | C12H13B2F3 |
| Molecular Weight | 235.85 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1ccc(C)cc1)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C12H13B2F3/c1-8-4-6-9(7-5-8)11(13,14)10(2,3)12(15,16)17/h4-7H,1-3H3 |
| InChIKey | APJWDNCGGZXUTN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174141231 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174141231?
The IUPAC name of CID 174141231 (CID 174141231) is not available.
What is the SMILES notation for CID 174141231?
The canonical SMILES for CID 174141231 is [B]C([B])(c1ccc(C)cc1)C(C)(C)C(F)(F)F.
What is the InChIKey of CID 174141231?
The InChIKey is APJWDNCGGZXUTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13B2F3/c1-8-4-6-9(7-5-8)11(13,14)10(2,3)12(15,16)17/h4-7H,1-3H3.
What are the key properties of CID 174141231?
CID 174141231 has a molecular weight of 235.85 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174141231 is sourced from PubChem (CID 174141231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).