C25H26BF3O2 — CID 174141348
2-[7-[3-ethyl-5-(trifluoromethyl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174141348) has the molecular formula C25H26BF3O2 and a molecular weight of 426.29 g/mol. Its IUPAC name is 2-[7-[3-ethyl-5-(trifluoromethyl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[7-[3-ethyl-5-(trifluoromethyl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174141348 |
| Molecular Formula | C25H26BF3O2 |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-[7-[3-ethyl-5-(trifluoromethyl)phenyl]naphthalen-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCc1cc(-c2ccc3ccc(B4OC(C)(C)C(C)(C)O4)cc3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H26BF3O2/c1-6-16-11-19(14-21(12-16)25(27,28)29)18-8-7-17-9-10-22(15-20(17)13-18)26-30-23(2,3)24(4,5)31-26/h7-15H,6H2,1-5H3 |
| InChIKey | KCDPNXLRNSGBPW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|