About CID 174141417
CID 174141417 (PubChem CID 174141417) has the molecular formula C52H31B3FN5O
and a molecular weight of 793.29 g/mol.
Molecular Properties
| Compound Name | CID 174141417 |
| PubChem CID | 174141417 |
| Molecular Formula | C52H31B3FN5O |
| Molecular Weight | 793.29 g/mol |
| Exact Mass | 793.28 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(-c2c(-c3ccccc3)cccc2-n2c3ccccc3c3ccc4c5ccccc5n(-c5nc(-c6ccccc6)nc(-c6cccc(F)c6)n5)c4c32)c(O)c([B])c1C |
| InChI | InChI=1S/C52H31B3FN5O/c1-29-44(53)46(55)43(49(62)45(29)54)42-34(30-14-4-2-5-15-30)22-13-25-41(42)60-39-23-10-8-20-35(39)37-26-27-38-36-21-9-11-24-40(36)61(48(38)47(37)60)52-58-50(31-16-6-3-7-17-31)57-51(59-52)32-18-12-19-33(56)28-32/h2-28,62H,1H3 |
| InChIKey | NEROZIYDTQJTNC-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 793.29 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174141417 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174141417?
The IUPAC name of CID 174141417 (CID 174141417) is not available.
What is the SMILES notation for CID 174141417?
The canonical SMILES for CID 174141417 is [B]c1c([B])c(-c2c(-c3ccccc3)cccc2-n2c3ccccc3c3ccc4c5ccccc5n(-c5nc(-c6ccccc6)nc(-c6cccc(F)c6)n5)c4c32)c(O)c([B])c1C.
What is the InChIKey of CID 174141417?
The InChIKey is NEROZIYDTQJTNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H31B3FN5O/c1-29-44(53)46(55)43(49(62)45(29)54)42-34(30-14-4-2-5-15-30)22-13-25-41(42)60-39-23-10-8-20-35(39)37-26-27-38-36-21-9-11-24-40(36)61(48(38)47(37)60)52-58-50(31-16-6-3-7-17-31)57-51(59-52)32-18-12-19-33(56)28-32/h2-28,62H,1H3.
What are the key properties of CID 174141417?
CID 174141417 has a molecular weight of 793.29 g/mol, XLogP of 9.27, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174141417 is sourced from PubChem (CID 174141417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).