C24H46O6Si2 — CID 174141709
ethyl (3aR,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 174141709) has the molecular formula C24H46O6Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is ethyl (3aR,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 174141709 |
| Molecular Formula | C24H46O6Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | ethyl (3aR,7aR)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=CC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C24H46O6Si2/c1-14-26-21(25)16-15-17(29-31(10,11)22(2,3)4)19(30-32(12,13)23(5,6)7)20-18(16)27-24(8,9)28-20/h15,17-20H,14H2,1-13H3/t17?,18-,19?,20-/m1/s1 |
| InChIKey | MSVQMSVXCYPFHL-CQJJOKNBSA-N |
| XLogP | 5.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|