C9H12FN — CID 174141813
(5S)-5-fluoro-2,3,5,6,7,8-hexahydroquinoline (PubChem CID 174141813) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is (5S)-5-fluoro-2,3,5,6,7,8-hexahydroquinoline.
| Compound Name | (5S)-5-fluoro-2,3,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 174141813 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (5S)-5-fluoro-2,3,5,6,7,8-hexahydroquinoline |
| SMILES | F[C@H]1CCCC2=NCCC=C21 |
| InChI | InChI=1S/C9H12FN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h3,8H,1-2,4-6H2/t8-/m0/s1 |
| InChIKey | PPSQUJRCTHBNNF-QMMMGPOBSA-N |
| XLogP | 2.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |