About 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine
5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine (PubChem CID 174142646) has the molecular formula C12H21BrN4S
and a molecular weight of 333.30 g/mol. Its IUPAC name is 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine |
| PubChem CID | 174142646 |
| Molecular Formula | C12H21BrN4S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine |
| SMILES | CSNc1cc(Br)cnc1N(C)CCCN(C)C |
| InChI | InChI=1S/C12H21BrN4S/c1-16(2)6-5-7-17(3)12-11(15-18-4)8-10(13)9-14-12/h8-9,15H,5-7H2,1-4H3 |
| InChIKey | MHGKGYIWRUFWII-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine?
The IUPAC name of 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine (CID 174142646) is 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine.
What is the SMILES notation for 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine?
The canonical SMILES for 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine is CSNc1cc(Br)cnc1N(C)CCCN(C)C.
What is the InChIKey of 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine?
The InChIKey is MHGKGYIWRUFWII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21BrN4S/c1-16(2)6-5-7-17(3)12-11(15-18-4)8-10(13)9-14-12/h8-9,15H,5-7H2,1-4H3.
What are the key properties of 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine?
5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine has a molecular weight of 333.30 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-N-[3-(dimethylamino)propyl]-2-N-methyl-3-N-methylsulfanylpyridine-2,3-diamine is sourced from PubChem (CID 174142646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).