C20H22ClFN2O2S — CID 174143013
tert-butyl-[[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-2,3-dihydro-1H-inden-1-yl]amino]-oxidosulfanium (PubChem CID 174143013) has the molecular formula C20H22ClFN2O2S and a molecular weight of 408.93 g/mol. Its IUPAC name is tert-butyl-[[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-2,3-dihydro-1H-inden-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-2,3-dihydro-1H-inden-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174143013 |
| Molecular Formula | C20H22ClFN2O2S |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | tert-butyl-[[(1S)-4-[(3-chloro-4-fluorophenyl)carbamoyl]-2,3-dihydro-1H-inden-1-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H]1CCc2c(C(=O)Nc3ccc(F)c(Cl)c3)cccc21 |
| InChI | InChI=1S/C20H22ClFN2O2S/c1-20(2,3)27(26)24-18-10-8-13-14(18)5-4-6-15(13)19(25)23-12-7-9-17(22)16(21)11-12/h4-7,9,11,18,24H,8,10H2,1-3H3,(H,23,25)/t18-,27?/m0/s1 |
| InChIKey | RLMTZKXQXMZRKF-HSYKDVHTSA-N |
| XLogP | 4.77 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|