About ethene-1,1,2,2-tetramine;tetrahydrochloride
ethene-1,1,2,2-tetramine;tetrahydrochloride (PubChem CID 174143268) has the molecular formula C2H12Cl4N4
and a molecular weight of 233.96 g/mol. Its IUPAC name is ethene-1,1,2,2-tetramine;tetrahydrochloride.
Molecular Properties
| Compound Name | ethene-1,1,2,2-tetramine;tetrahydrochloride |
| PubChem CID | 174143268 |
| Molecular Formula | C2H12Cl4N4 |
| Molecular Weight | 233.96 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | ethene-1,1,2,2-tetramine;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.NC(N)=C(N)N |
| InChI | InChI=1S/C2H8N4.4ClH/c3-1(4)2(5)6;;;;/h3-6H2;4*1H |
| InChIKey | ZNTBWZZTPNXQLK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.96 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethene-1,1,2,2-tetramine;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene-1,1,2,2-tetramine;tetrahydrochloride?
The IUPAC name of ethene-1,1,2,2-tetramine;tetrahydrochloride (CID 174143268) is ethene-1,1,2,2-tetramine;tetrahydrochloride.
What is the SMILES notation for ethene-1,1,2,2-tetramine;tetrahydrochloride?
The canonical SMILES for ethene-1,1,2,2-tetramine;tetrahydrochloride is Cl.Cl.Cl.Cl.NC(N)=C(N)N.
What is the InChIKey of ethene-1,1,2,2-tetramine;tetrahydrochloride?
The InChIKey is ZNTBWZZTPNXQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N4.4ClH/c3-1(4)2(5)6;;;;/h3-6H2;4*1H.
What are the key properties of ethene-1,1,2,2-tetramine;tetrahydrochloride?
ethene-1,1,2,2-tetramine;tetrahydrochloride has a molecular weight of 233.96 g/mol, XLogP of -0.37, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene-1,1,2,2-tetramine;tetrahydrochloride is sourced from PubChem (CID 174143268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).