C29H34BN3O5 — CID 174144101
2-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indazole-7-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid (PubChem CID 174144101) has the molecular formula C29H34BN3O5 and a molecular weight of 515.42 g/mol. Its IUPAC name is 2-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indazole-7-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid.
| Compound Name | 2-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indazole-7-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 174144101 |
| Molecular Formula | C29H34BN3O5 |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-[[1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]indazole-7-carbonyl]amino]spiro[3.3]heptane-6-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(Cn3ncc4cccc(C(=O)NC5CC6(C5)CC(C(=O)O)C6)c43)cc2)OC1(C)C |
| InChI | InChI=1S/C29H34BN3O5/c1-27(2)28(3,4)38-30(37-27)21-10-8-18(9-11-21)17-33-24-19(16-31-33)6-5-7-23(24)25(34)32-22-14-29(15-22)12-20(13-29)26(35)36/h5-11,16,20,22H,12-15,17H2,1-4H3,(H,32,34)(H,35,36) |
| InChIKey | FFBDJBOKDIGENN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|