C34H47BN15O22P4 — CID 174144111
CID 174144111 (PubChem CID 174144111) has the molecular formula C34H47BN15O22P4 and a molecular weight of 1152.54 g/mol.
| Compound Name | CID 174144111 |
|---|---|
| PubChem CID | 174144111 |
| Molecular Formula | C34H47BN15O22P4 |
| Molecular Weight | 1152.54 g/mol |
| Exact Mass | 1152.21 |
| IUPAC Name | — |
| SMILES | [B-]P(=O)(OC[C@H]1O[C@@H]([n+]2cn(C)c3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1CC)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](OC)[C@@H]1OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H46BN15O22P4/c1-4-12-13(67-30(19(12)51)50-11-47(2)18-27(50)44-34(38)46-29(18)55)5-64-73(35,56)71-76(61,62)72-75(59,60)66-7-15-22(23(63-3)32(69-15)48-9-41-16-24(36)39-8-40-25(16)48)70-74(57,58)65-6-14-20(52)21(53)31(68-14)49-10-42-17-26(49)43-33(37)45-28(17)54/h8-15,19-23,30-32,51-53H,4-7H2,1-3H3,(H10-,36,37,38,39,40,43,44,45,46,54,55,57,58,59,60,61,62)/q-1/p+1/t12-,13-,14-,15-,19-,20-,21-,22-,23-,30-,31-,32-,73?/m1/s1 |
| InChIKey | DSNGXGIGLYVOAM-DHSNBPOSSA-O |
| XLogP | -2.87 |
| TPSA | 521.75 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 31 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1152.54 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 31 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|