About 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide
6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide (PubChem CID 174144489) has the molecular formula C9H13ClN4O3S
and a molecular weight of 292.75 g/mol. Its IUPAC name is 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide.
Molecular Properties
| Compound Name | 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide |
| PubChem CID | 174144489 |
| Molecular Formula | C9H13ClN4O3S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide |
| SMILES | CCON=C(N)c1ccc(S(=O)(=O)NC)c(Cl)n1 |
| InChI | InChI=1S/C9H13ClN4O3S/c1-3-17-14-9(11)6-4-5-7(8(10)13-6)18(15,16)12-2/h4-5,12H,3H2,1-2H3,(H2,11,14) |
| InChIKey | RLYLTVWNSUQIFS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide?
The IUPAC name of 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide (CID 174144489) is 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide.
What is the SMILES notation for 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide?
The canonical SMILES for 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide is CCON=C(N)c1ccc(S(=O)(=O)NC)c(Cl)n1.
What is the InChIKey of 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide?
The InChIKey is RLYLTVWNSUQIFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN4O3S/c1-3-17-14-9(11)6-4-5-7(8(10)13-6)18(15,16)12-2/h4-5,12H,3H2,1-2H3,(H2,11,14).
What are the key properties of 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide?
6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide has a molecular weight of 292.75 g/mol, XLogP of 0.30, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N'-ethoxy-5-(methylsulfamoyl)pyridine-2-carboximidamide is sourced from PubChem (CID 174144489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).