C26H56O3Si2 — CID 174144539
2,3-bis[tri(propan-2-yl)silyloxy]octanal (PubChem CID 174144539) has the molecular formula C26H56O3Si2 and a molecular weight of 472.90 g/mol. Its IUPAC name is 2,3-bis[tri(propan-2-yl)silyloxy]octanal.
| Compound Name | 2,3-bis[tri(propan-2-yl)silyloxy]octanal |
|---|---|
| PubChem CID | 174144539 |
| Molecular Formula | C26H56O3Si2 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.38 |
| IUPAC Name | 2,3-bis[tri(propan-2-yl)silyloxy]octanal |
| SMILES | CCCCCC(O[Si](C(C)C)(C(C)C)C(C)C)C(C=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H56O3Si2/c1-14-15-16-17-25(28-30(19(2)3,20(4)5)21(6)7)26(18-27)29-31(22(8)9,23(10)11)24(12)13/h18-26H,14-17H2,1-13H3 |
| InChIKey | RCOWCFMYLCBKHD-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|