C55H28B5NO3 — CID 174144701
CID 174144701 (PubChem CID 174144701) has the molecular formula C55H28B5NO3 and a molecular weight of 804.89 g/mol.
| Compound Name | CID 174144701 |
|---|---|
| PubChem CID | 174144701 |
| Molecular Formula | C55H28B5NO3 |
| Molecular Weight | 804.89 g/mol |
| Exact Mass | 805.25 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc3oc4cccc(N(c5ccc6c(c5)Oc5ccccc5C65c6ccccc6-c6ccccc65)c5cccc6oc7ccccc7c56)c4c3c2)c([B])c1[B] |
| InChI | InChI=1S/C55H28B5NO3/c56-50-47(51(57)53(59)54(60)52(50)58)29-23-26-42-34(27-29)49-40(18-10-22-45(49)63-42)61(39-17-9-21-44-48(39)33-13-3-7-19-41(33)62-44)30-24-25-38-46(28-30)64-43-20-8-6-16-37(43)55(38)35-14-4-1-11-31(35)32-12-2-5-15-36(32)55/h1-28H |
| InChIKey | GDVRYYWZMAKSKV-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 38.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.89 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|