About sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite
sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite (PubChem CID 174144794) has the molecular formula C7H6N2NaO3S2-
and a molecular weight of 253.26 g/mol. Its IUPAC name is sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite.
Molecular Properties
| Compound Name | sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite |
| PubChem CID | 174144794 |
| Molecular Formula | C7H6N2NaO3S2- |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite |
| SMILES | O=S([O-])Oc1ccc2[nH]c(=S)[nH]c2c1.[H-].[Na+] |
| InChI | InChI=1S/C7H6N2O3S2.Na.H/c10-14(11)12-4-1-2-5-6(3-4)9-7(13)8-5;;/h1-3H,(H,10,11)(H2,8,9,13);;/q;+1;-1/p-1 |
| InChIKey | HWUTYFAQFOHYKZ-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite?
The IUPAC name of sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite (CID 174144794) is sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite.
What is the SMILES notation for sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite?
The canonical SMILES for sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite is O=S([O-])Oc1ccc2[nH]c(=S)[nH]c2c1.[H-].[Na+].
What is the InChIKey of sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite?
The InChIKey is HWUTYFAQFOHYKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2O3S2.Na.H/c10-14(11)12-4-1-2-5-6(3-4)9-7(13)8-5;;/h1-3H,(H,10,11)(H2,8,9,13);;/q;+1;-1/p-1.
What are the key properties of sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite?
sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite has a molecular weight of 253.26 g/mol, XLogP of -1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl) sulfite is sourced from PubChem (CID 174144794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).