C20H29N5OSSi — CID 174145335
2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2H-1,3-thiazol-2-yl]pentanenitrile (PubChem CID 174145335) has the molecular formula C20H29N5OSSi and a molecular weight of 415.64 g/mol. Its IUPAC name is 2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2H-1,3-thiazol-2-yl]pentanenitrile.
| Compound Name | 2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2H-1,3-thiazol-2-yl]pentanenitrile |
|---|---|
| PubChem CID | 174145335 |
| Molecular Formula | C20H29N5OSSi |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]-2H-1,3-thiazol-2-yl]pentanenitrile |
| SMILES | CCCC(C#N)C1SC=CN1c1ncnc2c1ccn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H29N5OSSi/c1-5-6-16(13-21)20-25(9-11-27-20)19-17-7-8-24(18(17)22-14-23-19)15-26-10-12-28(2,3)4/h7-9,11,14,16,20H,5-6,10,12,15H2,1-4H3 |
| InChIKey | VUBAEROLQVLEOI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|