C14H20LiNO4 — CID 174145347
lithium;hydride;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 174145347) has the molecular formula C14H20LiNO4 and a molecular weight of 273.26 g/mol. Its IUPAC name is lithium;hydride;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | lithium;hydride;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174145347 |
| Molecular Formula | C14H20LiNO4 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | lithium;hydride;2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C14H19NO4.Li.H/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10;;/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17);;/q;+1;-1 |
| InChIKey | ARTDBWVBTUDLKK-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |