C28H24AsClFN5O2S — CID 174145563
CID 174145563 (PubChem CID 174145563) has the molecular formula C28H24AsClFN5O2S and a molecular weight of 623.97 g/mol.
| Compound Name | CID 174145563 |
|---|---|
| PubChem CID | 174145563 |
| Molecular Formula | C28H24AsClFN5O2S |
| Molecular Weight | 623.97 g/mol |
| Exact Mass | 623.05 |
| IUPAC Name | — |
| SMILES | Cc1nc(-c2ncccn2)sc1C(=O)N1C[C@@H]2C(Oc3cc(C(C)(C)[As])cc(-c4ccc(Cl)c(F)c4)n3)[C@@H]2C1 |
| InChI | InChI=1S/C28H24AsClFN5O2S/c1-14-24(39-26(34-14)25-32-7-4-8-33-25)27(37)36-12-17-18(13-36)23(17)38-22-11-16(28(2,3)29)10-21(35-22)15-5-6-19(30)20(31)9-15/h4-11,17-18,23H,12-13H2,1-3H3/t17-,18+,23? |
| InChIKey | NNSHJZIMJWHBHS-NHJWOMDBSA-N |
| XLogP | 5.32 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.97 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|