C38H50N4O4 — CID 174145724
N-[5-[3-[6-(2,2-dimethylpropanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-2,2-dimethylpropanamide (PubChem CID 174145724) has the molecular formula C38H50N4O4 and a molecular weight of 626.84 g/mol. Its IUPAC name is N-[5-[3-[6-(2,2-dimethylpropanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[3-[6-(2,2-dimethylpropanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 174145724 |
| Molecular Formula | C38H50N4O4 |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.38 |
| IUPAC Name | N-[5-[3-[6-(2,2-dimethylpropanoylimino)-1,2,3,3-tetramethyl-2H-indol-5-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-1,2,3,3-tetramethyl-2H-indol-6-yl]-2,2-dimethylpropanamide |
| SMILES | CC1N(C)C2=C/C(=N\C(=O)C(C)(C)C)C(=C3C(=O)C(c4cc5c(cc4NC(=O)C(C)(C)C)N(C)C(C)C5(C)C)=C3O)C=C2C1(C)C |
| InChI | InChI=1S/C38H50N4O4/c1-19-37(9,10)23-15-21(25(17-27(23)41(19)13)39-33(45)35(3,4)5)29-31(43)30(32(29)44)22-16-24-28(42(14)20(2)38(24,11)12)18-26(22)40-34(46)36(6,7)8/h15-20,43H,1-14H3,(H,39,45)/b30-22?,40-26+ |
| InChIKey | RDWAGYJYFDGFTJ-YOPOTIHDSA-N |
| XLogP | 7.13 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|