C38H38N2Si+2 — CID 174145898
trimethyl-[(2E)-26-methyl-6-phenyl-4,30-diazoniahexacyclo[16.12.0.04,9.010,15.019,24.025,30]triaconta-2,4(9),5,7,10,12,14,19,21,23,25,27,29-tridecaen-7-yl]silane (PubChem CID 174145898) has the molecular formula C38H38N2Si+2 and a molecular weight of 550.82 g/mol. Its IUPAC name is trimethyl-[(2E)-26-methyl-6-phenyl-4,30-diazoniahexacyclo[16.12.0.04,9.010,15.019,24.025,30]triaconta-2,4(9),5,7,10,12,14,19,21,23,25,27,29-tridecaen-7-yl]silane.
| Compound Name | trimethyl-[(2E)-26-methyl-6-phenyl-4,30-diazoniahexacyclo[16.12.0.04,9.010,15.019,24.025,30]triaconta-2,4(9),5,7,10,12,14,19,21,23,25,27,29-tridecaen-7-yl]silane |
|---|---|
| PubChem CID | 174145898 |
| Molecular Formula | C38H38N2Si+2 |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | trimethyl-[(2E)-26-methyl-6-phenyl-4,30-diazoniahexacyclo[16.12.0.04,9.010,15.019,24.025,30]triaconta-2,4(9),5,7,10,12,14,19,21,23,25,27,29-tridecaen-7-yl]silane |
| SMILES | Cc1ccc[n+]2c1-c1ccccc1C1CCc3ccccc3-c3cc([Si](C)(C)C)c(-c4ccccc4)c[n+]3/C=C/C12 |
| InChI | InChI=1S/C38H38N2Si/c1-27-13-12-23-40-35-22-24-39-26-34(28-14-6-5-7-15-28)37(41(2,3)4)25-36(39)30-17-9-8-16-29(30)20-21-32(35)31-18-10-11-19-33(31)38(27)40/h5-19,22-26,32,35H,20-21H2,1-4H3/q+2/b24-22+ |
| InChIKey | AAWLHVSIKYVWHN-ZNTNEXAZSA-N |
| XLogP | 7.87 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|