C15H22BN2O2P — CID 174146034
N,3-bis(ethenyl)-N-phosphanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 174146034) has the molecular formula C15H22BN2O2P and a molecular weight of 304.14 g/mol. Its IUPAC name is N,3-bis(ethenyl)-N-phosphanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | N,3-bis(ethenyl)-N-phosphanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 174146034 |
| Molecular Formula | C15H22BN2O2P |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N,3-bis(ethenyl)-N-phosphanyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | C=Cc1c(B2OC(C)(C)C(C)(C)O2)ccnc1N(P)C=C |
| InChI | InChI=1S/C15H22BN2O2P/c1-7-11-12(9-10-17-13(11)18(21)8-2)16-19-14(3,4)15(5,6)20-16/h7-10H,1-2,21H2,3-6H3 |
| InChIKey | ASECJPXUJUXIIW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|