About 3,5-dimethyl-1,3-azaborole
3,5-dimethyl-1,3-azaborole (PubChem CID 174146299) has the molecular formula C5H8BN
and a molecular weight of 92.94 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-azaborole.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3-azaborole |
| PubChem CID | 174146299 |
| Molecular Formula | C5H8BN |
| Molecular Weight | 92.94 g/mol |
| Exact Mass | 93.07 |
| IUPAC Name | 3,5-dimethyl-1,3-azaborole |
| SMILES | CB1C=NC(C)=C1 |
| InChI | InChI=1S/C5H8BN/c1-5-3-6(2)4-7-5/h3-4H,1-2H3 |
| InChIKey | YCTSNGHFJJLQDV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.94 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1,3-azaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3-azaborole?
The IUPAC name of 3,5-dimethyl-1,3-azaborole (CID 174146299) is 3,5-dimethyl-1,3-azaborole.
What is the SMILES notation for 3,5-dimethyl-1,3-azaborole?
The canonical SMILES for 3,5-dimethyl-1,3-azaborole is CB1C=NC(C)=C1.
What is the InChIKey of 3,5-dimethyl-1,3-azaborole?
The InChIKey is YCTSNGHFJJLQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BN/c1-5-3-6(2)4-7-5/h3-4H,1-2H3.
What are the key properties of 3,5-dimethyl-1,3-azaborole?
3,5-dimethyl-1,3-azaborole has a molecular weight of 92.94 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3-azaborole is sourced from PubChem (CID 174146299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).