C14H14F2N4O6S — CID 174146563
[2-[N'-(3,4-difluorobenzoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174146563) has the molecular formula C14H14F2N4O6S and a molecular weight of 404.35 g/mol. Its IUPAC name is [2-[N'-(3,4-difluorobenzoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[N'-(3,4-difluorobenzoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174146563 |
| Molecular Formula | C14H14F2N4O6S |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [2-[N'-(3,4-difluorobenzoyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)c1ccc(F)c(F)c1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H14F2N4O6S/c15-9-3-1-7(5-10(9)16)13(21)18-12(17)11-4-2-8-6-19(11)14(22)20(8)26-27(23,24)25/h1,3,5,8,11H,2,4,6H2,(H2,17,18,21)(H,23,24,25) |
| InChIKey | TUBIRFSAMYCXNE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|