C21H28BCl2N5O6Si — CID 174147133
[3-[3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propoxy]-4-nitrophenyl]boronic acid (PubChem CID 174147133) has the molecular formula C21H28BCl2N5O6Si and a molecular weight of 556.29 g/mol. Its IUPAC name is [3-[3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propoxy]-4-nitrophenyl]boronic acid.
| Compound Name | [3-[3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propoxy]-4-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 174147133 |
| Molecular Formula | C21H28BCl2N5O6Si |
| Molecular Weight | 556.29 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | [3-[3-[[2,5-dichloro-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propoxy]-4-nitrophenyl]boronic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(Cl)c2c(NCCCOc3cc(B(O)O)ccc3[N+](=O)[O-])nc(Cl)nc21 |
| InChI | InChI=1S/C21H28BCl2N5O6Si/c1-36(2,3)10-9-34-13-28-12-15(23)18-19(26-21(24)27-20(18)28)25-7-4-8-35-17-11-14(22(30)31)5-6-16(17)29(32)33/h5-6,11-12,30-31H,4,7-10,13H2,1-3H3,(H,25,26,27) |
| InChIKey | ZFMKWUNLFPZWIW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 144.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|