About (E)-2-methoxy-5,7-dimethyldec-7-en-3-one
(E)-2-methoxy-5,7-dimethyldec-7-en-3-one (PubChem CID 174147360) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is (E)-2-methoxy-5,7-dimethyldec-7-en-3-one.
Molecular Properties
| Compound Name | (E)-2-methoxy-5,7-dimethyldec-7-en-3-one |
| PubChem CID | 174147360 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (E)-2-methoxy-5,7-dimethyldec-7-en-3-one |
| SMILES | CC/C=C(\C)CC(C)CC(=O)C(C)OC |
| InChI | InChI=1S/C13H24O2/c1-6-7-10(2)8-11(3)9-13(14)12(4)15-5/h7,11-12H,6,8-9H2,1-5H3/b10-7+ |
| InChIKey | ZOGAWIRRDXTFNO-JXMROGBWSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methoxy-5,7-dimethyldec-7-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methoxy-5,7-dimethyldec-7-en-3-one?
The IUPAC name of (E)-2-methoxy-5,7-dimethyldec-7-en-3-one (CID 174147360) is (E)-2-methoxy-5,7-dimethyldec-7-en-3-one.
What is the SMILES notation for (E)-2-methoxy-5,7-dimethyldec-7-en-3-one?
The canonical SMILES for (E)-2-methoxy-5,7-dimethyldec-7-en-3-one is CC/C=C(\C)CC(C)CC(=O)C(C)OC.
What is the InChIKey of (E)-2-methoxy-5,7-dimethyldec-7-en-3-one?
The InChIKey is ZOGAWIRRDXTFNO-JXMROGBWSA-N. The full InChI is InChI=1S/C13H24O2/c1-6-7-10(2)8-11(3)9-13(14)12(4)15-5/h7,11-12H,6,8-9H2,1-5H3/b10-7+.
What are the key properties of (E)-2-methoxy-5,7-dimethyldec-7-en-3-one?
(E)-2-methoxy-5,7-dimethyldec-7-en-3-one has a molecular weight of 212.33 g/mol, XLogP of 3.36, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methoxy-5,7-dimethyldec-7-en-3-one is sourced from PubChem (CID 174147360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).