C16H25B — CID 174147795
1-(2,3-dimethylphenyl)-3,3,4,4-tetramethylborolane (PubChem CID 174147795) has the molecular formula C16H25B and a molecular weight of 228.19 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3,3,4,4-tetramethylborolane.
| Compound Name | 1-(2,3-dimethylphenyl)-3,3,4,4-tetramethylborolane |
|---|---|
| PubChem CID | 174147795 |
| Molecular Formula | C16H25B |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3,3,4,4-tetramethylborolane |
| SMILES | Cc1cccc(B2CC(C)(C)C(C)(C)C2)c1C |
| InChI | InChI=1S/C16H25B/c1-12-8-7-9-14(13(12)2)17-10-15(3,4)16(5,6)11-17/h7-9H,10-11H2,1-6H3 |
| InChIKey | VEVKJZVASYLLSF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|