C20H23BrClFN4S — CID 174148646
5-bromo-4-[(1R,2R,5S)-2-but-1-en-2-yl-3-azabicyclo[3.2.1]octan-3-yl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 174148646) has the molecular formula C20H23BrClFN4S and a molecular weight of 485.85 g/mol. Its IUPAC name is 5-bromo-4-[(1R,2R,5S)-2-but-1-en-2-yl-3-azabicyclo[3.2.1]octan-3-yl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 5-bromo-4-[(1R,2R,5S)-2-but-1-en-2-yl-3-azabicyclo[3.2.1]octan-3-yl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 174148646 |
| Molecular Formula | C20H23BrClFN4S |
| Molecular Weight | 485.85 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 5-bromo-4-[(1R,2R,5S)-2-but-1-en-2-yl-3-azabicyclo[3.2.1]octan-3-yl]-7-chloro-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | C=C(CC)[C@H]1[C@@H]2CC[C@@H](C2)CN1c1nc(SCC)nc2c(F)c(Cl)nc(Br)c12 |
| InChI | InChI=1S/C20H23BrClFN4S/c1-4-10(3)16-12-7-6-11(8-12)9-27(16)19-13-15(24-20(26-19)28-5-2)14(23)18(22)25-17(13)21/h11-12,16H,3-9H2,1-2H3/t11-,12+,16-/m0/s1 |
| InChIKey | YQTOOUMDIUPCDA-OZVIIMIRSA-N |
| XLogP | 6.26 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.85 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|