C36H36F2N3O6SSi+ — CID 174148753
(2,5-dioxopyrrolidin-1-yl) 4-[7-(1,1-dioxo-1,4-thiazinan-4-yl)-5-ethenyl-5-methyl-3-piperidin-1-ium-1-ylidenebenzo[b][1]benzosilin-10-yl]-3,5-difluorobenzoate (PubChem CID 174148753) has the molecular formula C36H36F2N3O6SSi+ and a molecular weight of 704.85 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[7-(1,1-dioxo-1,4-thiazinan-4-yl)-5-ethenyl-5-methyl-3-piperidin-1-ium-1-ylidenebenzo[b][1]benzosilin-10-yl]-3,5-difluorobenzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[7-(1,1-dioxo-1,4-thiazinan-4-yl)-5-ethenyl-5-methyl-3-piperidin-1-ium-1-ylidenebenzo[b][1]benzosilin-10-yl]-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 174148753 |
| Molecular Formula | C36H36F2N3O6SSi+ |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 704.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[7-(1,1-dioxo-1,4-thiazinan-4-yl)-5-ethenyl-5-methyl-3-piperidin-1-ium-1-ylidenebenzo[b][1]benzosilin-10-yl]-3,5-difluorobenzoate |
| SMILES | C=C[Si]1(C)C2=CC(=[N+]3CCCCC3)C=CC2=C(c2c(F)cc(C(=O)ON3C(=O)CCC3=O)cc2F)c2ccc(N3CCS(=O)(=O)CC3)cc21 |
| InChI | InChI=1S/C36H36F2N3O6SSi/c1-3-49(2)30-21-24(39-13-5-4-6-14-39)7-9-26(30)34(27-10-8-25(22-31(27)49)40-15-17-48(45,46)18-16-40)35-28(37)19-23(20-29(35)38)36(44)47-41-32(42)11-12-33(41)43/h3,7-10,19-22H,1,4-6,11-18H2,2H3/q+1 |
| InChIKey | CFNUPOHDDWTFMH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|