C32H36F3N2O3Si+ — CID 174148783
[10-(4-acetyl-2,6-dimethoxyphenyl)-5-ethenyl-7-[ethyl(methyl)amino]-5-methylbenzo[b][1]benzosilin-3-ylidene]-methyl-(2,2,2-trifluoroethyl)azanium (PubChem CID 174148783) has the molecular formula C32H36F3N2O3Si+ and a molecular weight of 581.73 g/mol. Its IUPAC name is [10-(4-acetyl-2,6-dimethoxyphenyl)-5-ethenyl-7-[ethyl(methyl)amino]-5-methylbenzo[b][1]benzosilin-3-ylidene]-methyl-(2,2,2-trifluoroethyl)azanium.
| Compound Name | [10-(4-acetyl-2,6-dimethoxyphenyl)-5-ethenyl-7-[ethyl(methyl)amino]-5-methylbenzo[b][1]benzosilin-3-ylidene]-methyl-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 174148783 |
| Molecular Formula | C32H36F3N2O3Si+ |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | [10-(4-acetyl-2,6-dimethoxyphenyl)-5-ethenyl-7-[ethyl(methyl)amino]-5-methylbenzo[b][1]benzosilin-3-ylidene]-methyl-(2,2,2-trifluoroethyl)azanium |
| SMILES | C=C[Si]1(C)C2=C/C(=[N+](\C)CC(F)(F)F)C=CC2=C(c2c(OC)cc(C(C)=O)cc2OC)c2ccc(N(C)CC)cc21 |
| InChI | InChI=1S/C32H36F3N2O3Si/c1-9-36(4)22-11-13-24-28(17-22)41(8,10-2)29-18-23(37(5)19-32(33,34)35)12-14-25(29)30(24)31-26(39-6)15-21(20(3)38)16-27(31)40-7/h10-18H,2,9,19H2,1,3-8H3/q+1 |
| InChIKey | IQIQIDBBNRWDFB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 41.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|