C20H13B3FN7 — CID 174148933
CID 174148933 (PubChem CID 174148933) has the molecular formula C20H13B3FN7 and a molecular weight of 402.81 g/mol.
| Compound Name | CID 174148933 |
|---|---|
| PubChem CID | 174148933 |
| Molecular Formula | C20H13B3FN7 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C1(C#N)CCc2c(-c3ccnc4[nH]ncc34)c(-c3ccc(F)cn3)nn2C1 |
| InChI | InChI=1S/C20H13B3FN7/c21-20(22,23)19(9-25)5-3-15-16(12-4-6-26-18-13(12)8-28-29-18)17(30-31(15)10-19)14-2-1-11(24)7-27-14/h1-2,4,6-8H,3,5,10H2,(H,26,28,29) |
| InChIKey | QUPZBUYQMNCOPC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|