C22H32FN5O — CID 174149408
4-(3-azabicyclo[3.2.1]octan-3-yl)-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 174149408) has the molecular formula C22H32FN5O and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-(3-azabicyclo[3.2.1]octan-3-yl)-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 174149408 |
| Molecular Formula | C22H32FN5O |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 4-(3-azabicyclo[3.2.1]octan-3-yl)-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | F[C@H]1CN2CCCC2(COc2nc3c(c(N4CC5CCC(C5)C4)n2)CCNC3)C1 |
| InChI | InChI=1S/C22H32FN5O/c23-17-9-22(5-1-7-28(22)13-17)14-29-21-25-19-10-24-6-4-18(19)20(26-21)27-11-15-2-3-16(8-15)12-27/h15-17,24H,1-14H2/t15?,16?,17-,22?/m1/s1 |
| InChIKey | LQNWOGJHWYIPLN-OIZUCRILSA-N |
| XLogP | 2.31 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |