About (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride
(4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride (PubChem CID 174149422) has the molecular formula C8H14ClNO2S
and a molecular weight of 223.73 g/mol. Its IUPAC name is (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride |
| PubChem CID | 174149422 |
| Molecular Formula | C8H14ClNO2S |
| Molecular Weight | 223.73 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride |
| SMILES | C[C@H]([C@@H]1C=CC1S(=O)(=O)Cl)[C@@H](C)N |
| InChI | InChI=1S/C8H14ClNO2S/c1-5(6(2)10)7-3-4-8(7)13(9,11)12/h3-8H,10H2,1-2H3/t5-,6+,7-,8?/m0/s1 |
| InChIKey | OSJZKAFUJWFSBH-SZVWITLZSA-N |
| XLogP | 1.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.73 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride?
The IUPAC name of (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride (CID 174149422) is (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride.
What is the SMILES notation for (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride?
The canonical SMILES for (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride is C[C@H]([C@@H]1C=CC1S(=O)(=O)Cl)[C@@H](C)N.
What is the InChIKey of (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride?
The InChIKey is OSJZKAFUJWFSBH-SZVWITLZSA-N. The full InChI is InChI=1S/C8H14ClNO2S/c1-5(6(2)10)7-3-4-8(7)13(9,11)12/h3-8H,10H2,1-2H3/t5-,6+,7-,8?/m0/s1.
What are the key properties of (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride?
(4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride has a molecular weight of 223.73 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(2R,3R)-3-aminobutan-2-yl]cyclobut-2-ene-1-sulfonyl chloride is sourced from PubChem (CID 174149422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).