About (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene
(2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene (PubChem CID 174150100) has the molecular formula C10H11F
and a molecular weight of 150.20 g/mol. Its IUPAC name is (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene.
Molecular Properties
| Compound Name | (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene |
| PubChem CID | 174150100 |
| Molecular Formula | C10H11F |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene |
| SMILES | CC1=CC2CC2/C=C(/F)C=C1 |
| InChI | InChI=1S/C10H11F/c1-7-2-3-10(11)6-9-5-8(9)4-7/h2-4,6,8-9H,5H2,1H3/b3-2?,7-4?,10-6+ |
| InChIKey | PHRIUHWIPJJTNH-JGRYYUGRSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene?
The IUPAC name of (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene (CID 174150100) is (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene.
What is the SMILES notation for (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene?
The canonical SMILES for (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene is CC1=CC2CC2/C=C(/F)C=C1.
What is the InChIKey of (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene?
The InChIKey is PHRIUHWIPJJTNH-JGRYYUGRSA-N. The full InChI is InChI=1S/C10H11F/c1-7-2-3-10(11)6-9-5-8(9)4-7/h2-4,6,8-9H,5H2,1H3/b3-2?,7-4?,10-6+.
What are the key properties of (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene?
(2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene has a molecular weight of 150.20 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-fluoro-6-methylbicyclo[6.1.0]nona-2,4,6-triene is sourced from PubChem (CID 174150100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).