C27H32N6O5 — CID 174150242
6-[2-methyl-4-[2-[methyl-[(5-nitro-3H-pyrrol-4-yl)methyl]amino]ethoxy]anilino]-1-(oxan-4-yl)-3H-pyrrolo[3,2-c]pyridin-2-one (PubChem CID 174150242) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is 6-[2-methyl-4-[2-[methyl-[(5-nitro-3H-pyrrol-4-yl)methyl]amino]ethoxy]anilino]-1-(oxan-4-yl)-3H-pyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 6-[2-methyl-4-[2-[methyl-[(5-nitro-3H-pyrrol-4-yl)methyl]amino]ethoxy]anilino]-1-(oxan-4-yl)-3H-pyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 174150242 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 6-[2-methyl-4-[2-[methyl-[(5-nitro-3H-pyrrol-4-yl)methyl]amino]ethoxy]anilino]-1-(oxan-4-yl)-3H-pyrrolo[3,2-c]pyridin-2-one |
| SMILES | Cc1cc(OCCN(C)CC2=C([N+](=O)[O-])N=CC2)ccc1Nc1cc2c(cn1)CC(=O)N2C1CCOCC1 |
| InChI | InChI=1S/C27H32N6O5/c1-18-13-22(38-12-9-31(2)17-19-5-8-28-27(19)33(35)36)3-4-23(18)30-25-15-24-20(16-29-25)14-26(34)32(24)21-6-10-37-11-7-21/h3-4,8,13,15-16,21H,5-7,9-12,14,17H2,1-2H3,(H,29,30) |
| InChIKey | UAZILRZJZPFZTB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|