C11H12N4O3S — CID 174150315
6-methyl-4-methylimino-2,2-dioxo-2λ6-thia-3,5,8-triazabicyclo[7.3.1]trideca-1(12),5,9(13),10-tetraen-7-one (PubChem CID 174150315) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 6-methyl-4-methylimino-2,2-dioxo-2λ6-thia-3,5,8-triazabicyclo[7.3.1]trideca-1(12),5,9(13),10-tetraen-7-one.
| Compound Name | 6-methyl-4-methylimino-2,2-dioxo-2λ6-thia-3,5,8-triazabicyclo[7.3.1]trideca-1(12),5,9(13),10-tetraen-7-one |
|---|---|
| PubChem CID | 174150315 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 6-methyl-4-methylimino-2,2-dioxo-2λ6-thia-3,5,8-triazabicyclo[7.3.1]trideca-1(12),5,9(13),10-tetraen-7-one |
| SMILES | C/N=C1/N=C(C)C(=O)Nc2cccc(c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C11H12N4O3S/c1-7-10(16)14-8-4-3-5-9(6-8)19(17,18)15-11(12-2)13-7/h3-6H,1-2H3,(H,12,15)(H,14,16) |
| InChIKey | IRMZBCAUTJVPKQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|