C17H35O6PSi — CID 174150550
(3aS,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ol (PubChem CID 174150550) has the molecular formula C17H35O6PSi and a molecular weight of 394.52 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ol.
| Compound Name | (3aS,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 174150550 |
| Molecular Formula | C17H35O6PSi |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (3aS,4S,5R,6aS)-4-[tert-butyl(dimethyl)silyl]oxy-2-(dimethoxyphosphorylmethyl)-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ol |
| SMILES | COP(=O)(CC1(O)C[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@@H]2O1)OC |
| InChI | InChI=1S/C17H35O6PSi/c1-12-9-14-13(15(12)23-25(7,8)16(2,3)4)10-17(18,22-14)11-24(19,20-5)21-6/h12-15,18H,9-11H2,1-8H3/t12-,13+,14+,15+,17?/m1/s1 |
| InChIKey | RQJCXFVJILCXTL-GWTPXXFDSA-N |
| XLogP | 4.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|