C24H40O2Si — CID 174150556
(3aS,4R,5R,6aR)-4-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 174150556) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-4-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-4-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 174150556 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (3aS,4R,5R,6aR)-4-[(E,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyloct-1-en-6-ynyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC#CC[C@H](C)[C@@H](/C=C/[C@@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40O2Si/c1-9-10-11-17(2)23(26-27(7,8)24(4,5)6)13-12-21-18(3)14-19-15-20(25)16-22(19)21/h12-13,17-19,21-23H,11,14-16H2,1-8H3/b13-12+/t17-,18+,19+,21-,22-,23+/m0/s1 |
| InChIKey | BVKINIPTYRQUDN-CWAYKIQYSA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|